191-24-2 Benzo[ghi]perylene
Nazwa produktu: |
Benzo[ghi]perylene |
Angielska nazwa |
Benzo[ghi]perylene; 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
MF |
C22H12 |
Masie cząsteczkowej |
276.3307 |
InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
Nr CAS |
191-24-2 |
EINECS |
205-883-8 |
Struktury molekularnej |
|
Gęstość |
1.378g/cm3 |
Temperatura topnienia |
276-280℃ |
Temperatura wrzenia |
501°C at 760 mmHg |
Współczynnik załamania |
2.009 |
Temperatura zapłonu |
247.2°C |
Ciśnienie pary |
1.12E-09mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|